Cysteine (data page)
From Infogalactic: the planetary knowledge core
The complete data for Cysteine | ||||||||||||||||
200px Chemical structure of the amino acid cysteine |
General information 200px Chemical formula: C3H7NO2S
Molar mass: 121.16 g·mol−1 Systematic name: (2R)-2-amino-3-sulfanyl-propanoic acid Abbreviations: C, Cys Synonyms: 2-amino-3-mercaptopropanoic acid 2-amino-3-mercaptopropionic acid 2-amino-3-sulfanylpropanoic acid 3-mercaptoalanine AIDS{-}160777 CHEBI:15356 CHEMBANK2703 NSC 63864 NSC647530 NSC8746 Zystein |
|||||||||||||||
Database data | ||||||||||||||||
SMILES: SCC(N)C(=O)O InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/f/h5H
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |