Digallic acid

Digallic acid

200px meta-depside bond digalloyl ester
Names
IUPAC name 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid
Other names Digallate 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyloxy)benzoate m-digallic acid Digalloyl ester
Identifiers
CAS Number	536-08-3 Y
ChEMBL	ChEMBL366356 N
ChemSpider	334 N
Jmol 3D model	Interactive image Interactive image
PubChem	341
InChI InChI=1S/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21) N Key: COVFEVWNJUOYRL-UHFFFAOYSA-N N InChI=1/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21) Key: COVFEVWNJUOYRL-UHFFFAOYAG
SMILES C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)[O-] O=C(O)c2cc(O)c(O)c(OC(=O)c1cc(O)c(O)c(O)c1)c2
Properties
Chemical formula	C14H10O9
Molar mass	322.22 g/mol
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

Digallic acid is a polyphenolic compound found in Pistacia lentiscus. Digallic acid is also present in the molecule of tannic acid. Digalloyl esters involve either -meta or -para depside bonds.

Tannase is an enzyme that uses digallate to produce gallic acid. This enzyme can also be used to produce digallic acid from gallotannins.