Ethyl carfluzepate

Ethyl carfluzepate

Systematic (IUPAC) name
Ethyl 7-chloro-5-(2-fluorophenyl)-1-(methylcarbamoyl)-2-oxo-3H-1,4-benzodiazepine-3-carboxylate
Identifiers
CAS Number	65400-85-3 N
PubChem	CID: 68856
ChemSpider	62089 Y
UNII	36M73UIK01 N
Chemical data
Formula	C20H17ClFN3O4
Molecular mass	417.818
SMILES CCOC(=O)C1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3F)C(=O)NC
InChI InChI=1S/C20H17ClFN3O4/c1-3-29-19(27)17-18(26)25(20(28)23-2)15-9-8-11(21)10-13(15)16(24-17)12-6-4-5-7-14(12)22/h4-10,17H,3H2,1-2H3,(H,23,28) Y Key:PUJLIQLPZOZCOP-UHFFFAOYSA-N Y
NY (what is this?)  (verify)

Ethyl carfluzepate is mainly a hypnotic drug which is a benzodiazepine derivative and induces sleep in a strong manner. It is similar to ethyl loflazepate in chemical structure, the other difference being an absence of methylcarbamoyl group. Its also similar in metabolism to this substance, only the methyl-carboxylate group would be the difference between the main metabolites. Two of the main metabolites must be the 3-hydroxylate or the substance with only a hydrogen atom at the 3-position of the molecule structure. In order to that the resulting main metabolite could probably be ethyl-7-cloro-5-(2-fluorophenyl)-1-methylcarbamate)-2-oxo-3H-1,4-benzodiazepine-3-hydroxylate (and the 3-OH instead of the 3H metabolite). Its properties are mainly sedative and hypnotic.