O-806

O-806

Systematic (IUPAC) name
(6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
Identifiers
PubChem	CID: 10549140
ChemSpider	26001356 Y
Chemical data
Formula	C22H27BrO2
Molecular mass	403.352 g/mol
SMILES C3C1C(CC=C3C)C(C)(C)Oc(c2)c1c(O)cc2CC#CCCCBr
InChI InChI=1S/C22H27BrO2/c1-15-9-10-18-17(12-15)21-19(24)13-16(8-6-4-5-7-11-23)14-20(21)25-22(18,2)3/h9,13-14,17-18,24H,5,7-8,10-12H2,1-3H3/t17-,18-/m1/s1 Y Key:QHFROVGTWNPDOW-QZTJIDSGSA-N Y
(verify)

O-806 is a drug which is a cannabinoid derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid receptor CB₁, meaning that it acts as an antagonist when co-administered alongside a more potent CB₁ agonist, but exhibits weak partial agonist effects when administered by itself.